C20H23ClN4O6S — CID 5033110
N-(2-chloro-5-nitrophenyl)-2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 5033110) has the molecular formula C20H23ClN4O6S and a molecular weight of 482.95 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 5033110 |
| Molecular Formula | C20H23ClN4O6S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H23ClN4O6S/c1-31-18-8-5-14(11-19(18)32(29,30)24-9-3-2-4-10-24)22-13-20(26)23-17-12-15(25(27)28)6-7-16(17)21/h5-8,11-12,22H,2-4,9-10,13H2,1H3,(H,23,26) |
| InChIKey | XWLCADXOLGRTLU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|