C20H23Cl2N3O3S — CID 55345481
N-(2,5-dichlorophenyl)-2-(4-methyl-3-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 55345481) has the molecular formula C20H23Cl2N3O3S and a molecular weight of 456.40 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(4-methyl-3-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(4-methyl-3-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 55345481 |
| Molecular Formula | C20H23Cl2N3O3S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(4-methyl-3-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)Nc2cc(Cl)ccc2Cl)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H23Cl2N3O3S/c1-14-5-7-16(12-19(14)29(27,28)25-9-3-2-4-10-25)23-13-20(26)24-18-11-15(21)6-8-17(18)22/h5-8,11-12,23H,2-4,9-10,13H2,1H3,(H,24,26) |
| InChIKey | IIHHOSRXKNAFFU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |