C20H21Cl2N3O4S — CID 26893607
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 26893607) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26893607 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O4S/c21-15-6-9-17(22)18(12-15)24-19(26)13-23-20(27)14-4-7-16(8-5-14)30(28,29)25-10-2-1-3-11-25/h4-9,12H,1-3,10-11,13H2,(H,23,27)(H,24,26) |
| InChIKey | YQOMJEBQSRZNIO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |