C21H23Cl2N3O4S — CID 42905167
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 42905167) has the molecular formula C21H23Cl2N3O4S and a molecular weight of 484.41 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42905167 |
| Molecular Formula | C21H23Cl2N3O4S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(C(=O)NCC(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O4S/c1-14-4-2-3-11-26(14)31(29,30)17-8-5-15(6-9-17)21(28)24-13-20(27)25-19-12-16(22)7-10-18(19)23/h5-10,12,14H,2-4,11,13H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | IUANACVSISVJLS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |