C21H22F3N3O4S — CID 146122746
3-(2-methylpiperidin-1-yl)sulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 146122746) has the molecular formula C21H22F3N3O4S and a molecular weight of 469.49 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)sulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 146122746 |
| Molecular Formula | C21H22F3N3O4S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)sulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C21H22F3N3O4S/c1-13-5-2-3-10-27(13)32(30,31)15-7-4-6-14(11-15)21(29)25-12-18(28)26-17-9-8-16(22)19(23)20(17)24/h4,6-9,11,13H,2-3,5,10,12H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | SFNNSXPXYVJNDZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|