C19H18F3N3O5S — CID 43009760
3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 43009760) has the molecular formula C19H18F3N3O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 43009760 |
| Molecular Formula | C19H18F3N3O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H18F3N3O5S/c20-14-4-5-15(18(22)17(14)21)24-16(26)11-23-19(27)12-2-1-3-13(10-12)31(28,29)25-6-8-30-9-7-25/h1-5,10H,6-9,11H2,(H,23,27)(H,24,26) |
| InChIKey | CWWNKDVKRMATMW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|