C20H20F3N3O6S — CID 4845634
4-methoxy-3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 4845634) has the molecular formula C20H20F3N3O6S and a molecular weight of 487.46 g/mol. Its IUPAC name is 4-methoxy-3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 4-methoxy-3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 4845634 |
| Molecular Formula | C20H20F3N3O6S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-methoxy-3-morpholin-4-ylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H20F3N3O6S/c1-31-15-5-2-12(10-16(15)33(29,30)26-6-8-32-9-7-26)20(28)24-11-17(27)25-14-4-3-13(21)18(22)19(14)23/h2-5,10H,6-9,11H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | OISJQSJMODZHSO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|