C18H16ClF3N2O5S — CID 30147469
2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 30147469) has the molecular formula C18H16ClF3N2O5S and a molecular weight of 464.85 g/mol. Its IUPAC name is 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 30147469 |
| Molecular Formula | C18H16ClF3N2O5S |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)N1CCOCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16ClF3N2O5S/c19-11-1-4-14(15(9-11)30(26,27)24-5-7-28-8-6-24)29-10-16(25)23-13-3-2-12(20)17(21)18(13)22/h1-4,9H,5-8,10H2,(H,23,25) |
| InChIKey | CHCHUBSLGMEUID-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|