C17H25ClN2O5S — CID 30147306
2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 30147306) has the molecular formula C17H25ClN2O5S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 30147306 |
| Molecular Formula | C17H25ClN2O5S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)COc1ccc(Cl)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H25ClN2O5S/c1-3-4-13(2)19-17(21)12-25-15-6-5-14(18)11-16(15)26(22,23)20-7-9-24-10-8-20/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | KUNUZXSPZYZGRS-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |