C17H23ClN2O6S — CID 30146041
2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 30146041) has the molecular formula C17H23ClN2O6S and a molecular weight of 418.90 g/mol. Its IUPAC name is 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 30146041 |
| Molecular Formula | C17H23ClN2O6S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-(4-chloro-2-morpholin-4-ylsulfonylphenoxy)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)N1CCOCC1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H23ClN2O6S/c18-13-3-4-15(26-12-17(21)19-11-14-2-1-7-25-14)16(10-13)27(22,23)20-5-8-24-9-6-20/h3-4,10,14H,1-2,5-9,11-12H2,(H,19,21)/t14-/m0/s1 |
| InChIKey | ZAYFIEJKTUDYOI-AWEZNQCLSA-N |
| XLogP | 1.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |