C18H25ClN2O5S — CID 27242841
2-[4-chloro-2-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]-N-cyclopentylacetamide (PubChem CID 27242841) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is 2-[4-chloro-2-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]-N-cyclopentylacetamide.
| Compound Name | 2-[4-chloro-2-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 27242841 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[4-chloro-2-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]-N-cyclopentylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)NC[C@H]1CCCO1)NC1CCCC1 |
| InChI | InChI=1S/C18H25ClN2O5S/c19-13-7-8-16(26-12-18(22)21-14-4-1-2-5-14)17(10-13)27(23,24)20-11-15-6-3-9-25-15/h7-8,10,14-15,20H,1-6,9,11-12H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | PIAIGLYCEVIXFV-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |