C19H26N2O6S — CID 7976970
[2-(cyclopentylamino)-2-oxoethyl] 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7976970) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7976970 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1)NC1CCCC1 |
| InChI | InChI=1S/C19H26N2O6S/c22-18(21-15-6-1-2-7-15)13-27-19(23)14-5-3-9-17(11-14)28(24,25)20-12-16-8-4-10-26-16/h3,5,9,11,15-16,20H,1-2,4,6-8,10,12-13H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | BOYPVPIPITYUHA-INIZCTEOSA-N |
| XLogP | 1.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |