C20H23NO5S — CID 7976761
(4-methylphenyl)methyl 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7976761) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | (4-methylphenyl)methyl 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7976761 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (4-methylphenyl)methyl 3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | Cc1ccc(COC(=O)c2cccc(S(=O)(=O)NC[C@@H]3CCCO3)c2)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-15-7-9-16(10-8-15)14-26-20(22)17-4-2-6-19(12-17)27(23,24)21-13-18-5-3-11-25-18/h2,4,6-10,12,18,21H,3,5,11,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | PDRUPTKSTJBNMJ-SFHVURJKSA-N |
| XLogP | 2.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |