C15H18N2O5S — CID 7976917
[(1R)-1-cyanoethyl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7976917) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7976917 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | C[C@H](C#N)OC(=O)c1cccc(S(=O)(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C15H18N2O5S/c1-11(9-16)22-15(18)12-4-2-6-14(8-12)23(19,20)17-10-13-5-3-7-21-13/h2,4,6,8,11,13,17H,3,5,7,10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | JXHWQZHHOSBJPU-DGCLKSJQSA-N |
| XLogP | 1.21 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |