C14H18N2O6S — CID 7976955
(2-amino-2-oxoethyl) 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7976955) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7976955 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | NC(=O)COC(=O)c1cccc(S(=O)(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C14H18N2O6S/c15-13(17)9-22-14(18)10-3-1-5-12(7-10)23(19,20)16-8-11-4-2-6-21-11/h1,3,5,7,11,16H,2,4,6,8-9H2,(H2,15,17)/t11-/m1/s1 |
| InChIKey | QXKNLKSQEUYVQN-LLVKDONJSA-N |
| XLogP | -0.21 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |