C22H28N2O8S3 — CID 20967101
N-(oxolan-2-ylmethyl)-3-[3-(oxolan-2-ylmethylsulfamoyl)phenyl]sulfonylbenzenesulfonamide (PubChem CID 20967101) has the molecular formula C22H28N2O8S3 and a molecular weight of 544.67 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-3-[3-(oxolan-2-ylmethylsulfamoyl)phenyl]sulfonylbenzenesulfonamide.
| Compound Name | N-(oxolan-2-ylmethyl)-3-[3-(oxolan-2-ylmethylsulfamoyl)phenyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 20967101 |
| Molecular Formula | C22H28N2O8S3 |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-3-[3-(oxolan-2-ylmethylsulfamoyl)phenyl]sulfonylbenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1cccc(S(=O)(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H28N2O8S3/c25-33(26,19-7-1-9-21(13-19)34(27,28)23-15-17-5-3-11-31-17)20-8-2-10-22(14-20)35(29,30)24-16-18-6-4-12-32-18/h1-2,7-10,13-14,17-18,23-24H,3-6,11-12,15-16H2 |
| InChIKey | UQRHUGFJIJSGRX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |