C15H20N2O6S — CID 7976905
[(2S)-1-amino-1-oxopropan-2-yl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 7976905) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 7976905 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(S(=O)(=O)NC[C@H]2CCCO2)c1)C(N)=O |
| InChI | InChI=1S/C15H20N2O6S/c1-10(14(16)18)23-15(19)11-4-2-6-13(8-11)24(20,21)17-9-12-5-3-7-22-12/h2,4,6,8,10,12,17H,3,5,7,9H2,1H3,(H2,16,18)/t10-,12+/m0/s1 |
| InChIKey | OKNIBZMVURITOL-CMPLNLGQSA-N |
| XLogP | 0.17 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |