C16H21NO6S — CID 42988391
3-oxobutan-2-yl 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42988391) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-oxobutan-2-yl 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | 3-oxobutan-2-yl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42988391 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-oxobutan-2-yl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(=O)C(C)OC(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-11(18)12(2)23-16(19)13-5-7-15(8-6-13)24(20,21)17-10-14-4-3-9-22-14/h5-8,12,14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | UGIDHLXYKOSYIT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |