C21H23NO6S — CID 42983106
[2-(4-methylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42983106) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42983106 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(S(=O)(=O)NCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C21H23NO6S/c1-15-4-6-16(7-5-15)20(23)14-28-21(24)17-8-10-19(11-9-17)29(25,26)22-13-18-3-2-12-27-18/h4-11,18,22H,2-3,12-14H2,1H3 |
| InChIKey | RXGFICZKPNLNSL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |