C22H25NO6S — CID 42983105
[2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42983105) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42983105 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(S(=O)(=O)NCC3CCCO3)cc2)cc1C |
| InChI | InChI=1S/C22H25NO6S/c1-15-5-6-18(12-16(15)2)21(24)14-29-22(25)17-7-9-20(10-8-17)30(26,27)23-13-19-4-3-11-28-19/h5-10,12,19,23H,3-4,11,13-14H2,1-2H3 |
| InChIKey | SIJLPXXTUFJBGP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |