C22H32N2O6S — CID 42988399
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42988399) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42988399 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32N2O6S/c1-2-24(18-7-4-3-5-8-18)21(25)16-30-22(26)17-10-12-20(13-11-17)31(27,28)23-15-19-9-6-14-29-19/h10-13,18-19,23H,2-9,14-16H2,1H3 |
| InChIKey | FXEOKWSUWHIBMT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |