C15H21NO6S — CID 2943598
ethyl 2-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]acetate (PubChem CID 2943598) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is ethyl 2-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]acetate.
| Compound Name | ethyl 2-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 2943598 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 2-[4-(oxolan-2-ylmethylsulfamoyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C15H21NO6S/c1-2-20-15(17)11-22-12-5-7-14(8-6-12)23(18,19)16-10-13-4-3-9-21-13/h5-8,13,16H,2-4,9-11H2,1H3 |
| InChIKey | MRUXGTXAJUZSQN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |