C14H19N3O4S2 — CID 17161298
N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]acetamide (PubChem CID 17161298) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]acetamide.
| Compound Name | N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17161298 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-10(18)16-14(22)17-11-4-6-13(7-5-11)23(19,20)15-9-12-3-2-8-21-12/h4-7,12,15H,2-3,8-9H2,1H3,(H2,16,17,18,22) |
| InChIKey | DWGZGLGIEBQMCW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|