C19H20ClN3O4S2 — CID 17161309
3-chloro-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17161309) has the molecular formula C19H20ClN3O4S2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 3-chloro-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17161309 |
| Molecular Formula | C19H20ClN3O4S2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 3-chloro-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O4S2/c20-14-4-1-3-13(11-14)18(24)23-19(28)22-15-6-8-17(9-7-15)29(25,26)21-12-16-5-2-10-27-16/h1,3-4,6-9,11,16,21H,2,5,10,12H2,(H2,22,23,24,28) |
| InChIKey | STHQMPUCSDMNTC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|