C22H27N3O7S2 — CID 17161275
3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17161275) has the molecular formula C22H27N3O7S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17161275 |
| Molecular Formula | C22H27N3O7S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NCC3CCCO3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O7S2/c1-29-18-11-14(12-19(30-2)20(18)31-3)21(26)25-22(33)24-15-6-8-17(9-7-15)34(27,28)23-13-16-5-4-10-32-16/h6-9,11-12,16,23H,4-5,10,13H2,1-3H3,(H2,24,25,26,33) |
| InChIKey | CDUTYYSKAPTBAE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|