C20H23N3O8S — CID 41300869
4,5-dimethoxy-2-nitro-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide (PubChem CID 41300869) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide.
| Compound Name | 4,5-dimethoxy-2-nitro-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 41300869 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(=O)(=O)NC[C@H]3CCCO3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H23N3O8S/c1-29-18-10-16(17(23(25)26)11-19(18)30-2)20(24)22-13-5-7-15(8-6-13)32(27,28)21-12-14-4-3-9-31-14/h5-8,10-11,14,21H,3-4,9,12H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | YFONSCQJUSJMGV-CQSZACIVSA-N |
| XLogP | 2.32 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|