C18H18N4O8S — CID 17147099
2,4-dinitro-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide (PubChem CID 17147099) has the molecular formula C18H18N4O8S and a molecular weight of 450.43 g/mol. Its IUPAC name is 2,4-dinitro-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide.
| Compound Name | 2,4-dinitro-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17147099 |
| Molecular Formula | C18H18N4O8S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2,4-dinitro-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O8S/c23-18(16-8-5-13(21(24)25)10-17(16)22(26)27)20-12-3-6-15(7-4-12)31(28,29)19-11-14-2-1-9-30-14/h3-8,10,14,19H,1-2,9,11H2,(H,20,23) |
| InChIKey | UIYHZAJEFJDFIT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|