C19H20N4O7S — CID 24539929
3-[[(3-nitrobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 24539929) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is 3-[[(3-nitrobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-[[(3-nitrobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24539929 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-[[(3-nitrobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)NCC2CCCO2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N4O7S/c24-18(13-4-1-6-15(10-13)23(26)27)21-22-19(25)14-5-2-8-17(11-14)31(28,29)20-12-16-7-3-9-30-16/h1-2,4-6,8,10-11,16,20H,3,7,9,12H2,(H,21,24)(H,22,25) |
| InChIKey | GLYPAGJIPXVACH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|