C19H20BrN3O5S — CID 46652327
3-[[(2-bromobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 46652327) has the molecular formula C19H20BrN3O5S and a molecular weight of 482.36 g/mol. Its IUPAC name is 3-[[(2-bromobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-[[(2-bromobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46652327 |
| Molecular Formula | C19H20BrN3O5S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 3-[[(2-bromobenzoyl)amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1ccccc1Br)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C19H20BrN3O5S/c20-17-9-2-1-8-16(17)19(25)23-22-18(24)13-5-3-7-15(11-13)29(26,27)21-12-14-6-4-10-28-14/h1-3,5,7-9,11,14,21H,4,6,10,12H2,(H,22,24)(H,23,25) |
| InChIKey | WLHOHGOMKRNWCZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|