C17H19BrN2O4S2 — CID 55867907
N-[(4-bromothiophen-2-yl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55867907) has the molecular formula C17H19BrN2O4S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55867907 |
| Molecular Formula | C17H19BrN2O4S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H19BrN2O4S2/c18-13-8-15(25-11-13)10-19-17(21)12-3-1-5-16(7-12)26(22,23)20-9-14-4-2-6-24-14/h1,3,5,7-8,11,14,20H,2,4,6,9-10H2,(H,19,21) |
| InChIKey | JGQFEQHYICAMIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |