C19H27N3O5S — CID 55364440
3-(oxolan-2-ylmethylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 55364440) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 3-(oxolan-2-ylmethylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 55364440 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-(oxolan-2-ylmethylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCC(=O)N1CCCC1)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C19H27N3O5S/c23-18(22-10-1-2-11-22)8-9-20-19(24)15-5-3-7-17(13-15)28(25,26)21-14-16-6-4-12-27-16/h3,5,7,13,16,21H,1-2,4,6,8-12,14H2,(H,20,24) |
| InChIKey | ICPIOWKINXFRBY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |