C17H25N3O5S — CID 43020050
3-(oxolan-2-ylmethylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide (PubChem CID 43020050) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide.
| Compound Name | 3-(oxolan-2-ylmethylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 43020050 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-(oxolan-2-ylmethylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide |
| SMILES | CCCNC(=O)CNC(=O)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H25N3O5S/c1-2-8-18-16(21)12-19-17(22)13-5-3-7-15(10-13)26(23,24)20-11-14-6-4-9-25-14/h3,5,7,10,14,20H,2,4,6,8-9,11-12H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | JMFHIYVUDXUTLQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |