C20H29N3O6S — CID 42910636
ethyl 4-[[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 42910636) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is ethyl 4-[[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42910636 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl 4-[[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C20H29N3O6S/c1-2-28-20(25)23-10-8-16(9-11-23)22-19(24)15-5-3-7-18(13-15)30(26,27)21-14-17-6-4-12-29-17/h3,5,7,13,16-17,21H,2,4,6,8-12,14H2,1H3,(H,22,24) |
| InChIKey | DLRYOAQMPPFVAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |