C20H28N2O6S — CID 43002481
ethyl 1-[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]piperidine-4-carboxylate (PubChem CID 43002481) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl 1-[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43002481 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | ethyl 1-[3-(oxolan-2-ylmethylsulfamoyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-2-27-20(24)15-8-10-22(11-9-15)19(23)16-5-3-7-18(13-16)29(25,26)21-14-17-6-4-12-28-17/h3,5,7,13,15,17,21H,2,4,6,8-12,14H2,1H3 |
| InChIKey | UCOJZXIJBADYSY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |