C17H23N3O5S — CID 109063902
3-(4-formylpiperazine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 109063902) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-(4-formylpiperazine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-(4-formylpiperazine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 109063902 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-(4-formylpiperazine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=CN1CCN(C(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C17H23N3O5S/c21-13-19-6-8-20(9-7-19)17(22)14-3-1-5-16(11-14)26(23,24)18-12-15-4-2-10-25-15/h1,3,5,11,13,15,18H,2,4,6-10,12H2 |
| InChIKey | VFTJEVLRKSBPGR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|