C17H23FN2O4S — CID 136519074
3-(3-fluoro-3-methylpyrrolidine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 136519074) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-(3-fluoro-3-methylpyrrolidine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-(3-fluoro-3-methylpyrrolidine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 136519074 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(3-fluoro-3-methylpyrrolidine-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | CC1(F)CCN(C(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)C1 |
| InChI | InChI=1S/C17H23FN2O4S/c1-17(18)7-8-20(12-17)16(21)13-4-2-6-15(10-13)25(22,23)19-11-14-5-3-9-24-14/h2,4,6,10,14,19H,3,5,7-9,11-12H2,1H3 |
| InChIKey | DLAMHZRBEXHYRI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |