C16H19FN2O5S — CID 119259392
1-[3-(cyclopropylmethylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119259392) has the molecular formula C16H19FN2O5S and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(cyclopropylmethylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259392 |
| Molecular Formula | C16H19FN2O5S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[3-(cyclopropylmethylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1cccc(S(=O)(=O)NCC2CC2)c1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C16H19FN2O5S/c17-16(15(21)22)6-7-19(10-16)14(20)12-2-1-3-13(8-12)25(23,24)18-9-11-4-5-11/h1-3,8,11,18H,4-7,9-10H2,(H,21,22) |
| InChIKey | JIGFXWQTXQJKNB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |