C17H22N2O5S2 — CID 119210899
2-[4-[3-(cyclopropylmethylsulfamoyl)benzoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210899) has the molecular formula C17H22N2O5S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[4-[3-(cyclopropylmethylsulfamoyl)benzoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(cyclopropylmethylsulfamoyl)benzoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210899 |
| Molecular Formula | C17H22N2O5S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[4-[3-(cyclopropylmethylsulfamoyl)benzoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1cccc(S(=O)(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C17H22N2O5S2/c20-16(21)9-14-11-25-7-6-19(14)17(22)13-2-1-3-15(8-13)26(23,24)18-10-12-4-5-12/h1-3,8,12,14,18H,4-7,9-11H2,(H,20,21) |
| InChIKey | FLXIWSVUEOXIOO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |