2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid

C13H13Cl2NO3S — CID 66445224

IUPAC2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid
SMILESO=C(O)CC1CSCCN1C(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H13Cl2NO3S/c14-10-2-1-8(5-11(10)15)13(19)16-3-4-20-7-9(16)6-12(17)18/h1-2,5,9H,3-4,6-7H2,(H,17,18)
InChIKeyQGICVVHZBOILKW-UHFFFAOYSA-N
MW334.22 g/mol
LogP3.03
Rot. Bonds3

About 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid

2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66445224) has the molecular formula C13H13Cl2NO3S and a molecular weight of 334.22 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid
PubChem CID66445224
Molecular FormulaC13H13Cl2NO3S
Molecular Weight334.22 g/mol
Exact Mass333.00
IUPAC Name2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid
SMILESO=C(O)CC1CSCCN1C(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H13Cl2NO3S/c14-10-2-1-8(5-11(10)15)13(19)16-3-4-20-7-9(16)6-12(17)18/h1-2,5,9H,3-4,6-7H2,(H,17,18)
InChIKeyQGICVVHZBOILKW-UHFFFAOYSA-N
XLogP3.03
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.22
LogP ≤ 53.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid?
The IUPAC name of 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid (CID 66445224) is 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid?
The canonical SMILES for 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid is O=C(O)CC1CSCCN1C(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid?
The InChIKey is QGICVVHZBOILKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO3S/c14-10-2-1-8(5-11(10)15)13(19)16-3-4-20-7-9(16)6-12(17)18/h1-2,5,9H,3-4,6-7H2,(H,17,18).
What are the key properties of 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid?
2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid has a molecular weight of 334.22 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dichlorobenzoyl)thiomorpholin-3-yl]acetic acid is sourced from PubChem (CID 66445224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).