C13H15NO5S — CID 107702692
2-[4-(3,5-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 107702692) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[4-(3,5-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(3,5-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107702692 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[4-(3,5-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H15NO5S/c15-10-3-8(4-11(16)6-10)13(19)14-1-2-20-7-9(14)5-12(17)18/h3-4,6,9,15-16H,1-2,5,7H2,(H,17,18) |
| InChIKey | JOIUJUVCYHIGKY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |