C13H14ClNO4S — CID 106500352
2-[4-(2-chloro-5-hydroxybenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 106500352) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-[4-(2-chloro-5-hydroxybenzoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2-chloro-5-hydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 106500352 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[4-(2-chloro-5-hydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C13H14ClNO4S/c14-11-2-1-9(16)6-10(11)13(19)15-3-4-20-7-8(15)5-12(17)18/h1-2,6,8,16H,3-5,7H2,(H,17,18) |
| InChIKey | NBCBWJDJZZQNIS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |