C11H12ClNO3S2 — CID 66444651
2-[4-(5-chlorothiophene-2-carbonyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66444651) has the molecular formula C11H12ClNO3S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[4-(5-chlorothiophene-2-carbonyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(5-chlorothiophene-2-carbonyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66444651 |
| Molecular Formula | C11H12ClNO3S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2-[4-(5-chlorothiophene-2-carbonyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12ClNO3S2/c12-9-2-1-8(18-9)11(16)13-3-4-17-6-7(13)5-10(14)15/h1-2,7H,3-6H2,(H,14,15) |
| InChIKey | ULMWICUDXYLSCY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |