C13H15NO5S — CID 114343400
2-[4-(2,3-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 114343400) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2,3-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 114343400 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[4-(2,3-dihydroxybenzoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H15NO5S/c15-10-3-1-2-9(12(10)18)13(19)14-4-5-20-7-8(14)6-11(16)17/h1-3,8,15,18H,4-7H2,(H,16,17) |
| InChIKey | KULPFKFVHRDLJB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|