C15H19NO5S — CID 97318583
2-[(3S)-4-(2,5-dimethoxybenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 97318583) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[(3S)-4-(2,5-dimethoxybenzoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[(3S)-4-(2,5-dimethoxybenzoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 97318583 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[(3S)-4-(2,5-dimethoxybenzoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | COc1ccc(OC)c(C(=O)N2CCSC[C@@H]2CC(=O)O)c1 |
| InChI | InChI=1S/C15H19NO5S/c1-20-11-3-4-13(21-2)12(8-11)15(19)16-5-6-22-9-10(16)7-14(17)18/h3-4,8,10H,5-7,9H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | JXUYCYBSQHYISO-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |