C19H27NO5S — CID 119210980
2-[4-(4-butoxy-3-ethoxybenzoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 119210980) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is 2-[4-(4-butoxy-3-ethoxybenzoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(4-butoxy-3-ethoxybenzoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210980 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[4-(4-butoxy-3-ethoxybenzoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | CCCCOc1ccc(C(=O)N2CCSCC2CC(=O)O)cc1OCC |
| InChI | InChI=1S/C19H27NO5S/c1-3-5-9-25-16-7-6-14(11-17(16)24-4-2)19(23)20-8-10-26-13-15(20)12-18(21)22/h6-7,11,15H,3-5,8-10,12-13H2,1-2H3,(H,21,22) |
| InChIKey | DRDPBFJVFVUHSJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|