C21H23NO4S — CID 120520688
2-[4-[3-(2-ethoxyphenyl)benzoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 120520688) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[4-[3-(2-ethoxyphenyl)benzoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-ethoxyphenyl)benzoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 120520688 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[4-[3-(2-ethoxyphenyl)benzoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | CCOc1ccccc1-c1cccc(C(=O)N2CCSCC2CC(=O)O)c1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-26-19-9-4-3-8-18(19)15-6-5-7-16(12-15)21(25)22-10-11-27-14-17(22)13-20(23)24/h3-9,12,17H,2,10-11,13-14H2,1H3,(H,23,24) |
| InChIKey | IRXYOUDRIXOQOT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |