C16H22N2O4S — CID 120520600
2-[4-(2-butan-2-yloxypyridine-4-carbonyl)thiomorpholin-3-yl]acetic acid (PubChem CID 120520600) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[4-(2-butan-2-yloxypyridine-4-carbonyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2-butan-2-yloxypyridine-4-carbonyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 120520600 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[4-(2-butan-2-yloxypyridine-4-carbonyl)thiomorpholin-3-yl]acetic acid |
| SMILES | CCC(C)Oc1cc(C(=O)N2CCSCC2CC(=O)O)ccn1 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-11(2)22-14-8-12(4-5-17-14)16(21)18-6-7-23-10-13(18)9-15(19)20/h4-5,8,11,13H,3,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | DLEDBVJFDMZWKN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |