C16H22N2O4 — CID 120537390
(2R)-1-(2-butan-2-yloxypyridine-4-carbonyl)piperidine-2-carboxylic acid (PubChem CID 120537390) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R)-1-(2-butan-2-yloxypyridine-4-carbonyl)piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-(2-butan-2-yloxypyridine-4-carbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120537390 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2R)-1-(2-butan-2-yloxypyridine-4-carbonyl)piperidine-2-carboxylic acid |
| SMILES | CCC(C)Oc1cc(C(=O)N2CCCC[C@@H]2C(=O)O)ccn1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-11(2)22-14-10-12(7-8-17-14)15(19)18-9-5-4-6-13(18)16(20)21/h7-8,10-11,13H,3-6,9H2,1-2H3,(H,20,21)/t11?,13-/m1/s1 |
| InChIKey | PVSDCDVBGLRSFC-GLGOKHISSA-N |
| XLogP | 2.34 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |