C13H15FN2O3 — CID 61295467
methyl 1-(2-fluoropyridine-4-carbonyl)piperidine-2-carboxylate (PubChem CID 61295467) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is methyl 1-(2-fluoropyridine-4-carbonyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(2-fluoropyridine-4-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 61295467 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 1-(2-fluoropyridine-4-carbonyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C13H15FN2O3/c1-19-13(18)10-4-2-3-7-16(10)12(17)9-5-6-15-11(14)8-9/h5-6,8,10H,2-4,7H2,1H3 |
| InChIKey | QMPDFTDIVOOAHT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|