C16H21N3O5 — CID 112531565
methyl 1-[2-[(methoxycarbonylamino)methyl]pyridine-4-carbonyl]piperidine-2-carboxylate (PubChem CID 112531565) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 1-[2-[(methoxycarbonylamino)methyl]pyridine-4-carbonyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-[(methoxycarbonylamino)methyl]pyridine-4-carbonyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 112531565 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 1-[2-[(methoxycarbonylamino)methyl]pyridine-4-carbonyl]piperidine-2-carboxylate |
| SMILES | COC(=O)NCc1cc(C(=O)N2CCCCC2C(=O)OC)ccn1 |
| InChI | InChI=1S/C16H21N3O5/c1-23-15(21)13-5-3-4-8-19(13)14(20)11-6-7-17-12(9-11)10-18-16(22)24-2/h6-7,9,13H,3-5,8,10H2,1-2H3,(H,18,22) |
| InChIKey | USQIURODBBLKEY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |